EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H39NO3 |
| Net Charge | 0 |
| Average Mass | 377.569 |
| Monoisotopic Mass | 377.29299 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](N(CCO)CCO)CC[C@@]21[H] |
| InChI | InChI=1S/C23H39NO3/c1-22-9-7-17(27)15-16(22)3-4-18-19-5-6-21(24(11-13-25)12-14-26)23(19,2)10-8-20(18)22/h3,17-21,25-27H,4-15H2,1-2H3/t17-,18-,19-,20-,21-,22-,23-/m0/s1 |
| InChIKey | IEQZBQLFRAVFHT-FQJIPJFPSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17beta-[Bis(2-hydroxyethyl)amino]androst-5-en-3beta-ol (CHEBI:79490) has role androgen (CHEBI:50113) |
| 17beta-[Bis(2-hydroxyethyl)amino]androst-5-en-3beta-ol (CHEBI:79490) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C14966 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:6956-93-0 | KEGG COMPOUND |