EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32O2S2 |
| Net Charge | 0 |
| Average Mass | 356.597 |
| Monoisotopic Mass | 356.18437 |
| SMILES | [H][C@@]12CC[C@@]3(S)C[C@H](O)C[C@H](S)[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H32O2S2/c1-17-7-6-14-12(13(17)3-4-15(17)21)5-8-19(23)10-11(20)9-16(22)18(14,19)2/h11-16,20-23H,3-10H2,1-2H3/t11-,12+,13+,14+,15+,16+,17+,18+,19-/m1/s1 |
| InChIKey | KIBKUPGGOWPDIJ-WEGHJKGXSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1alpha,5alpha-Dimercaptoandrostane-3alpha,17beta-diol (CHEBI:79484) has role androgen (CHEBI:50113) |
| 1alpha,5alpha-Dimercaptoandrostane-3alpha,17beta-diol (CHEBI:79484) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C14960 | KEGG COMPOUND |