EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)C(=O)CC[C@@]34[H])[C@@]1(C)C[C@@H](C)[C@@H](O)C2 |
| InChI | InChI=1S/C20H32O2/c1-12-11-20(3)13(10-17(12)21)4-5-14-15-6-7-18(22)19(15,2)9-8-16(14)20/h12-17,21H,4-11H2,1-3H3/t12-,13+,14+,15+,16+,17+,19+,20+/m1/s1 |
| InChIKey | FDGQIVOIHOIMNK-URBDGJAYSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3alpha-Hydroxy-2alpha-methyl-5alpha-androstan-17-one (CHEBI:79480) has role androgen (CHEBI:50113) |
| 3alpha-Hydroxy-2alpha-methyl-5alpha-androstan-17-one (CHEBI:79480) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonym | Source |
|---|---|
| 2alpha-Methylandrosterone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C14956 | KEGG COMPOUND |