EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O7 |
| Net Charge | 0 |
| Average Mass | 316.265 |
| Monoisotopic Mass | 316.05830 |
| SMILES | COc1cc2oc(-c3ccc(O)c(O)c3)cc(=O)c2c(O)c1O |
| InChI | InChI=1S/C16H12O7/c1-22-13-6-12-14(16(21)15(13)20)10(19)5-11(23-12)7-2-3-8(17)9(18)4-7/h2-6,17-18,20-21H,1H3 |
| InChIKey | QWUHUBDKQQPMQG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.17.3.2 (xanthine oxidase) inhibitor An EC 1.17.3.* (oxidoreductase acting on CH or CH2 with oxygen as acceptor) inhibitor that interferes with the action of xanthine oxidase (EC 1.17.3.2). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pedalitin (CHEBI:7947) has role EC 1.17.3.2 (xanthine oxidase) inhibitor (CHEBI:35634) |
| pedalitin (CHEBI:7947) has role metabolite (CHEBI:25212) |
| pedalitin (CHEBI:7947) is a monomethoxyflavone (CHEBI:25401) |
| pedalitin (CHEBI:7947) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,6-dihydroxy-7-methoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2-(3,4-dihydroxyphenyl)-5,6-dihydroxy-7-methoxy-4H-1-benzopyran-4-one | ChemIDplus |
| 2-(3,4-dihydroxyphenyl)-5,6-dihydroxy-7-methoxy-4H-chromen-4-one | ChEMBL |
| 3',4',5,6-Tetrahydroxy-7-methoxyflavone | KEGG COMPOUND |
| 3',4',5,6-Tetrahydroxy-7-methoxyflavone | ChemIDplus |
| Pedalitin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00003886 | KNApSAcK |
| C10119 | KEGG COMPOUND |
| HMDB0030804 | HMDB |
| LMPK12111231 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1296526 | Reaxys |
| CAS:22384-63-0 | KEGG COMPOUND |
| CAS:22384-63-0 | ChemIDplus |
| Citations |
|---|