EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O7 |
| Net Charge | 0 |
| Average Mass | 316.265 |
| Monoisotopic Mass | 316.05830 |
| SMILES | COc1cc2oc(-c3ccc(O)c(O)c3)cc(=O)c2c(O)c1O |
| InChI | InChI=1S/C16H12O7/c1-22-13-6-12-14(16(21)15(13)20)10(19)5-11(23-12)7-2-3-8(17)9(18)4-7/h2-6,17-18,20-21H,1H3 |
| InChIKey | QWUHUBDKQQPMQG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.17.3.2 (xanthine oxidase) inhibitor An EC 1.17.3.* (oxidoreductase acting on CH or CH2 with oxygen as acceptor) inhibitor that interferes with the action of xanthine oxidase (EC 1.17.3.2). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pedalitin (CHEBI:7947) has role EC 1.17.3.2 (xanthine oxidase) inhibitor (CHEBI:35634) |
| pedalitin (CHEBI:7947) has role metabolite (CHEBI:25212) |
| pedalitin (CHEBI:7947) is a monomethoxyflavone (CHEBI:25401) |
| pedalitin (CHEBI:7947) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,6-dihydroxy-7-methoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2-(3,4-dihydroxyphenyl)-5,6-dihydroxy-7-methoxy-4H-1-benzopyran-4-one | ChemIDplus |
| 2-(3,4-dihydroxyphenyl)-5,6-dihydroxy-7-methoxy-4H-chromen-4-one | ChEMBL |
| 3',4',5,6-Tetrahydroxy-7-methoxyflavone | KEGG COMPOUND |
| 3',4',5,6-Tetrahydroxy-7-methoxyflavone | ChemIDplus |
| Pedalitin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00003886 | KNApSAcK |
| C10119 | KEGG COMPOUND |
| HMDB0030804 | HMDB |
| LMPK12111231 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1296526 | Reaxys |
| CAS:22384-63-0 | KEGG COMPOUND |
| CAS:22384-63-0 | ChemIDplus |
| Citations |
|---|