EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | [H][C@]12CC[C@]3(C)[C@@H](O)CC[C@@]3([H])[C@]1([H])[C@H](O)CC1=CC(=O)C=C[C@@]12C |
| InChI | InChI=1S/C19H26O3/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h5,7,9,13-17,21-22H,3-4,6,8,10H2,1-2H3/t13-,14-,15+,16-,17-,18-,19-/m0/s1 |
| InChIKey | MXWNAVKICSVPAC-JUKXBMAYSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7alpha,17beta-Dihydroxyandrosta-1,4-dien-3-one (CHEBI:79433) has role androgen (CHEBI:50113) |
| 7alpha,17beta-Dihydroxyandrosta-1,4-dien-3-one (CHEBI:79433) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C14907 | KEGG COMPOUND |