EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33FO3 |
| Net Charge | 0 |
| Average Mass | 340.479 |
| Monoisotopic Mass | 340.24137 |
| SMILES | [H][C@@]12CC[C@@]3([H])[C@]4([H])CC[C@](C)(O)[C@@]4(C)C[C@H](O)[C@]3(F)[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C20H33FO3/c1-17-8-6-13(22)10-12(17)4-5-15-14-7-9-19(3,24)18(14,2)11-16(23)20(15,17)21/h12-16,22-24H,4-11H2,1-3H3/t12-,13-,14-,15-,16-,17-,18-,19-,20-/m0/s1 |
| InChIKey | XKASGEXHNLDQIB-AYWFNIBGSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3beta,5alpha,11beta,17beta)-9-Fluoro-17-methylandrostane-3,11,17-triol (CHEBI:79410) has role androgen (CHEBI:50113) |
| (3beta,5alpha,11beta,17beta)-9-Fluoro-17-methylandrostane-3,11,17-triol (CHEBI:79410) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonym | Source |
|---|---|
| 9-Fluoro-17alpha-methyl-5alpha-androstane-3beta,11beta,17-triol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C14883 | KEGG COMPOUND |