EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H36O2 |
| Net Charge | 0 |
| Average Mass | 320.517 |
| Monoisotopic Mass | 320.27153 |
| SMILES | [H][C@@]12C[C@H](C)[C@@]3([H])C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1(C)O |
| InChI | InChI=1S/C21H36O2/c1-13-11-15-16(19(2)8-5-14(22)12-18(13)19)6-9-20(3)17(15)7-10-21(20,4)23/h13-18,22-23H,5-12H2,1-4H3/t13-,14-,15+,16-,17-,18+,19+,20-,21-/m0/s1 |
| InChIKey | JGPUZUZZOULXJW-VLWKOFFBSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6alpha,17-Dimethyl-5alpha-androstane-3beta,17beta-diol (CHEBI:79405) has role androgen (CHEBI:50113) |
| 6alpha,17-Dimethyl-5alpha-androstane-3beta,17beta-diol (CHEBI:79405) is a 3-hydroxy steroid (CHEBI:36834) |
| Manual Xrefs | Databases |
|---|---|
| C14878 | KEGG COMPOUND |