EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H58N4O10.O4S |
| Net Charge | 0 |
| Average Mass | 923.051 |
| Monoisotopic Mass | 922.36702 |
| SMILES | O=S(=O)([O-])[O-].[H][C@@]12N(C=O)c3cc(OC)c([C@@]4(C(=O)OC)C[C@@H]5C[N@H+](CCc6c4nc4ccccc64)C[C@](O)(CC)C5)cc3[C@@]13CC[NH+]1CC=C[C@@](CC)([C@@H](OC(C)=O)[C@]2(O)C(=O)OC)[C@]13[H] |
| InChI | InChI=1S/C46H56N4O10.H2O4S/c1-7-42(55)22-28-23-45(40(53)58-5,36-30(14-18-48(24-28)25-42)29-12-9-10-13-33(29)47-36)32-20-31-34(21-35(32)57-4)50(26-51)38-44(31)16-19-49-17-11-15-43(8-2,37(44)49)39(60-27(3)52)46(38,56)41(54)59-6;1-5(2,3)4/h9-13,15,20-21,26,28,37-39,47,55-56H,7-8,14,16-19,22-25H2,1-6H3;(H2,1,2,3,4)/t28-,37+,38-,39-,42+,43-,44-,45+,46+;/m1./s1 |
| InChIKey | AQTQHPDCURKLKT-JKDPCDLQSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vincristine sulfate (CHEBI:79401) has part vincristine(2+) (CHEBI:143658) |
| vincristine sulfate (CHEBI:79401) has role antineoplastic agent (CHEBI:35610) |
| vincristine sulfate (CHEBI:79401) has role geroprotector (CHEBI:176497) |
| vincristine sulfate (CHEBI:79401) is a organic sulfate salt (CHEBI:51337) |
| Brand Names | Source |
|---|---|
| Marqibo | KEGG DRUG |
| Vincrex | KEGG DRUG |
| Vincasar | KEGG DRUG |
| Oncovin | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D02197 | KEGG DRUG |
| C13974 | KEGG COMPOUND |
| DBSALT000314 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:2068-78-2 | KEGG COMPOUND |
| CAS:2068-78-2 | KEGG DRUG |
| CAS:2068-78-2 | ChemIDplus |
| Citations |
|---|