EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15N3O2 |
| Net Charge | 0 |
| Average Mass | 257.293 |
| Monoisotopic Mass | 257.11643 |
| SMILES | [H][C@@]1([C@H](C)c2cnc3ccccc23)OC(NC)=NC1=O |
| InChI | InChI=1S/C14H15N3O2/c1-8(12-13(18)17-14(15-2)19-12)10-7-16-11-6-4-3-5-9(10)11/h3-8,12,16H,1-2H3,(H,15,17,18)/t8-,12+/m1/s1 |
| InChIKey | GNTVWGDQPXCYBV-PELKAZGASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces griseus (ncbitaxon:1911) | - | PubMed (809439) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 6.1.1.2 (tryptophan--tRNA ligase) inhibitor An EC 6.1.1.* (ligases forming aminoacyl tRNA and related compounds) inhibitor that interferes with the action of any tryptophan—tRNA ligase (EC 6.1.1.2). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indolmycin (CHEBI:79394) has role antibacterial agent (CHEBI:33282) |
| indolmycin (CHEBI:79394) has role antimicrobial agent (CHEBI:33281) |
| indolmycin (CHEBI:79394) has role bacterial metabolite (CHEBI:76969) |
| indolmycin (CHEBI:79394) has role EC 6.1.1.2 (tryptophan—tRNA ligase) inhibitor (CHEBI:79392) |
| indolmycin (CHEBI:79394) is a 1,3-oxazoles (CHEBI:46812) |
| indolmycin (CHEBI:79394) is a indoles (CHEBI:24828) |
| indolmycin (CHEBI:79394) is a secondary amino compound (CHEBI:50995) |
| indolmycin (CHEBI:79394) is conjugate base of indolmycin(1+) (CHEBI:91179) |
| Incoming Relation(s) |
| indolmycin(1+) (CHEBI:91179) is conjugate acid of indolmycin (CHEBI:79394) |
| IUPAC Name |
|---|
| (5S)-5-[(1R)-1-(1H-indol-3-yl)ethyl]-2-(methylamino)-1,3-oxazol-4(5H)-one |
| Synonyms | Source |
|---|---|
| (1R,5S)-(−)-5-(1-indol-3-ylethyl)-2-(methylamino)-2-oxazolin-4-one | ChemIDplus |
| (5S,6R)-(−)-indolmycin | ChEBI |
| indolemycin | ChemIDplus |
| (−)-indolmycin | ChEBI |
| PA 155 A | ChemIDplus |
| PA-155-A | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:620840 | Reaxys |
| CAS:21200-24-8 | ChemIDplus |
| Citations |
|---|