EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11NO2S |
| Net Charge | 0 |
| Average Mass | 233.292 |
| Monoisotopic Mass | 233.05105 |
| SMILES | C[C@H]1c2cnc3cccc(c23)S[C@H]1C(=O)O |
| InChI | InChI=1S/C12H11NO2S/c1-6-7-5-13-8-3-2-4-9(10(7)8)16-11(6)12(14)15/h2-6,11,13H,1H3,(H,14,15)/t6-,11+/m0/s1 |
| InChIKey | DKHFLDXCKWDVMF-UPONEAKYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinoplanes tsinanensis (ncbitaxon:2039464) | - | PubMed (327539) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. EC 6.1.1.2 (tryptophan--tRNA ligase) inhibitor An EC 6.1.1.* (ligases forming aminoacyl tRNA and related compounds) inhibitor that interferes with the action of any tryptophan—tRNA ligase (EC 6.1.1.2). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-chuangxinmycin (CHEBI:79391) has role antibacterial agent (CHEBI:33282) |
| (−)-chuangxinmycin (CHEBI:79391) has role antimicrobial agent (CHEBI:33281) |
| (−)-chuangxinmycin (CHEBI:79391) has role bacterial metabolite (CHEBI:76969) |
| (−)-chuangxinmycin (CHEBI:79391) has role EC 6.1.1.2 (tryptophan—tRNA ligase) inhibitor (CHEBI:79392) |
| (−)-chuangxinmycin (CHEBI:79391) is a indole alkaloid (CHEBI:38958) |
| (−)-chuangxinmycin (CHEBI:79391) is a monocarboxylic acid (CHEBI:25384) |
| (−)-chuangxinmycin (CHEBI:79391) is a thiinoindole (CHEBI:79393) |
| IUPAC Name |
|---|
| (2R,3S)-3-methyl-3,5-dihydro-2H-thiino[4,3,2-cd]indole-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| (−)-(4S,5R)-chuangxinmycin | ChEBI |
| (4S,5R)-(−)-chuangxinmycin | ChEBI |
| chuanghsinmycin | ChemIDplus |
| (−)-chuangxinmycin | ChEBI |
| chuangxinmycin | ChemIDplus |
| cis-(−)-3,5-dihydro-3-methyl-2H-thiopyrano(4,3,2-cd)indole-2-carboxylic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7796054 | Reaxys |
| CAS:63339-68-4 | ChemIDplus |
| Citations |
|---|