EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11NO2S |
| Net Charge | 0 |
| Average Mass | 233.292 |
| Monoisotopic Mass | 233.05105 |
| SMILES | C[C@H]1c2cnc3cccc(c23)S[C@H]1C(=O)O |
| InChI | InChI=1S/C12H11NO2S/c1-6-7-5-13-8-3-2-4-9(10(7)8)16-11(6)12(14)15/h2-6,11,13H,1H3,(H,14,15)/t6-,11+/m0/s1 |
| InChIKey | DKHFLDXCKWDVMF-UPONEAKYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinoplanes tsinanensis (ncbitaxon:2039464) | - | PubMed (327539) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. EC 6.1.1.2 (tryptophan--tRNA ligase) inhibitor An EC 6.1.1.* (ligases forming aminoacyl tRNA and related compounds) inhibitor that interferes with the action of any tryptophan—tRNA ligase (EC 6.1.1.2). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-chuangxinmycin (CHEBI:79391) has role antibacterial agent (CHEBI:33282) |
| (−)-chuangxinmycin (CHEBI:79391) has role antimicrobial agent (CHEBI:33281) |
| (−)-chuangxinmycin (CHEBI:79391) has role bacterial metabolite (CHEBI:76969) |
| (−)-chuangxinmycin (CHEBI:79391) has role EC 6.1.1.2 (tryptophan—tRNA ligase) inhibitor (CHEBI:79392) |
| (−)-chuangxinmycin (CHEBI:79391) is a indole alkaloid (CHEBI:38958) |
| (−)-chuangxinmycin (CHEBI:79391) is a monocarboxylic acid (CHEBI:25384) |
| (−)-chuangxinmycin (CHEBI:79391) is a thiinoindole (CHEBI:79393) |
| IUPAC Name |
|---|
| (2R,3S)-3-methyl-3,5-dihydro-2H-thiino[4,3,2-cd]indole-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| chuanghsinmycin | ChemIDplus |
| cis-(−)-3,5-dihydro-3-methyl-2H-thiopyrano(4,3,2-cd)indole-2-carboxylic acid | ChemIDplus |
| (−)-(4S,5R)-chuangxinmycin | ChEBI |
| (−)-chuangxinmycin | ChEBI |
| (4S,5R)-(−)-chuangxinmycin | ChEBI |
| chuangxinmycin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7796054 | Reaxys |
| CAS:63339-68-4 | ChemIDplus |
| Citations |
|---|