EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11NO3 |
| Net Charge | 0 |
| Average Mass | 157.169 |
| Monoisotopic Mass | 157.07389 |
| SMILES | [H][C@]1([C@H](N)C(=O)O)C=C[C@H](C)O1 |
| InChI | InChI=1S/C7H11NO3/c1-4-2-3-5(11-4)6(8)7(9)10/h2-6H,8H2,1H3,(H,9,10)/t4-,5+,6-/m0/s1 |
| InChIKey | PNOKUGWGMLEAPE-JKUQZMGJSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas fluorescens SBW25 (ncbitaxon:216595) | - | PubMed (23688329) | Strain: SBW25 |
| Streptomyces threomyceticus L-803 (ncbitaxon:ATCC 15795) | - | PubMed (4861779) | Strain: L-803 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| furanomycin (CHEBI:79390) has role antibacterial agent (CHEBI:33282) |
| furanomycin (CHEBI:79390) has role antimicrobial agent (CHEBI:33281) |
| furanomycin (CHEBI:79390) has role bacterial metabolite (CHEBI:76969) |
| furanomycin (CHEBI:79390) is a dihydrofuran (CHEBI:51659) |
| furanomycin (CHEBI:79390) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| (2S)-amino[(2R,5S)-5-methyl-2,5-dihydrofuran-2-yl]acetic acid |
| Synonyms | Source |
|---|---|
| (2S,2'R,5'S)-2-amino-2-(5'-methyl-2',5'-dihydrofuran-2'-yl)acetic acid | ChEBI |
| (6S)-2-amino-3,6-anhydro-2,4,5-trideoxy-6-methyl-D-threo-hex-4-enonic acid | IUPAC |
| (+)-furanomycin | ChEBI |
| L-(+)-furanomycin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Furanomycin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5254308 | Reaxys |
| CAS:18455-25-9 | ChemIDplus |
| Citations |
|---|