EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:7939 - parthenolide
| Formula | C15H20O3 |
| Net Charge | 0 |
| Average Mass | 248.322 |
| Monoisotopic Mass | 248.14124 |
| SMILES | [H][C@]12O[C@]1(C)CC/C=C(\C)CC[C@@]1([H])C(=C)C(=O)O[C@]21[H] |
| InChI | InChI=1S/C15H20O3/c1-9-5-4-8-15(3)13(18-15)12-11(7-6-9)10(2)14(16)17-12/h5,11-13H,2,4,6-8H2,1,3H3/b9-5+/t11-,12-,13+,15+/m0/s1 |
| InChIKey | KTEXNACQROZXEV-PVLRGYAZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. drug allergen Any drug which causes the onset of an allergic reaction. inhibitor A substance that diminishes the rate of a chemical reaction. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| parthenolide (CHEBI:7939) has role drug allergen (CHEBI:88188) |
| parthenolide (CHEBI:7939) has role inhibitor (CHEBI:35222) |
| parthenolide (CHEBI:7939) has role non-narcotic analgesic (CHEBI:35481) |
| parthenolide (CHEBI:7939) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| parthenolide (CHEBI:7939) has role peripheral nervous system drug (CHEBI:49110) |
| parthenolide (CHEBI:7939) is a sesquiterpene lactone (CHEBI:37667) |
| Incoming Relation(s) |
| 3β-hydroxyparthenolide (CHEBI:144561) has functional parent parthenolide (CHEBI:7939) |
| IUPAC Name |
|---|
| (1aR,4E,7aS,10aS,10bR)-1a,5-dimethyl-8-methylidene-2,3,6,7,7a,8,10a,10b-octahydrooxireno[9,10]cyclodeca[1,2-b]furan-9(1aH)-one |
| Synonyms | Source |
|---|---|
| 4,5-alpha-Epoxy-6-beta-hydroxygermacra-1(10),11(13)-dien-12-oic acid gamma-lactone | ChemIDplus |
| (-)-Parthenolide | ChemIDplus |
| Parthenolide | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| parthenolide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003345 | KNApSAcK |
| C07609 | KEGG COMPOUND |
| LMPR0103090002 | LIPID MAPS |
| Parthenolide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3550011 | Reaxys |
| CAS:20554-84-1 | ChemIDplus |
| CAS:20554-84-1 | KEGG COMPOUND |
| Citations |
|---|