EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O3 |
| Net Charge | 0 |
| Average Mass | 248.322 |
| Monoisotopic Mass | 248.14124 |
| SMILES | [H][C@]12O[C@]1(C)CC/C=C(\C)CC[C@@]1([H])C(=C)C(=O)O[C@]21[H] |
| InChI | InChI=1S/C15H20O3/c1-9-5-4-8-15(3)13(18-15)12-11(7-6-9)10(2)14(16)17-12/h5,11-13H,2,4,6-8H2,1,3H3/b9-5+/t11-,12-,13+,15+/m0/s1 |
| InChIKey | KTEXNACQROZXEV-PVLRGYAZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. inhibitor A substance that diminishes the rate of a chemical reaction. drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| parthenolide (CHEBI:7939) has role drug allergen (CHEBI:88188) |
| parthenolide (CHEBI:7939) has role inhibitor (CHEBI:35222) |
| parthenolide (CHEBI:7939) has role non-narcotic analgesic (CHEBI:35481) |
| parthenolide (CHEBI:7939) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| parthenolide (CHEBI:7939) has role peripheral nervous system drug (CHEBI:49110) |
| parthenolide (CHEBI:7939) is a sesquiterpene lactone (CHEBI:37667) |
| Incoming Relation(s) |
| 3β-hydroxyparthenolide (CHEBI:144561) has functional parent parthenolide (CHEBI:7939) |
| IUPAC Name |
|---|
| (1aR,4E,7aS,10aS,10bR)-1a,5-dimethyl-8-methylidene-2,3,6,7,7a,8,10a,10b-octahydrooxireno[9,10]cyclodeca[1,2-b]furan-9(1aH)-one |
| Synonyms | Source |
|---|---|
| 4,5-alpha-Epoxy-6-beta-hydroxygermacra-1(10),11(13)-dien-12-oic acid gamma-lactone | ChemIDplus |
| (-)-Parthenolide | ChemIDplus |
| Parthenolide | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| parthenolide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003345 | KNApSAcK |
| C07609 | KEGG COMPOUND |
| LMPR0103090002 | LIPID MAPS |
| Parthenolide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3550011 | Reaxys |
| CAS:20554-84-1 | ChemIDplus |
| CAS:20554-84-1 | KEGG COMPOUND |
| Citations |
|---|