EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H54O7 |
| Net Charge | 0 |
| Average Mass | 574.799 |
| Monoisotopic Mass | 574.38695 |
| SMILES | [H][C@@]12C[C@]3([H])[C@H](C(C)C)[C@@]([H])(OC(=O)CC(C)(O)CC(C)CC)C[C@@]3(C)C[C@@]1([H])/C(C)=C\C[C@]1([H])[C@@H](C)OC(=O)[C@H](O)[C@]1(O)C2=C |
| InChI | InChI=1S/C34H54O7/c1-10-19(4)14-33(9,38)17-28(35)41-27-16-32(8)15-24-20(5)11-12-25-22(7)40-31(37)30(36)34(25,39)21(6)23(24)13-26(32)29(27)18(2)3/h11,18-19,22-27,29-30,36,38-39H,6,10,12-17H2,1-5,7-9H3/b20-11-/t19?,22-,23+,24+,25-,26-,27+,29+,30+,32-,33?,34+/m1/s1 |
| InChIKey | WYHGVXYOQWYOQA-WHRQVDIESA-N |
| Roles Classification |
|---|
| Biological Roles: | glycerophosphoinositol synthesis inhibitor A pathway inhibitor that disrupts the synthesis of glycerophosphoinositol fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| YW3548 (CHEBI:79385) has role fungal metabolite (CHEBI:76946) |
| YW3548 (CHEBI:79385) has role glycerophosphoinositol synthesis inhibitor (CHEBI:79386) |
| YW3548 (CHEBI:79385) is a olefinic compound (CHEBI:78840) |
| YW3548 (CHEBI:79385) is a terpene lactone (CHEBI:37668) |
| YW3548 (CHEBI:79385) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1R,4R,4aR,6Z,7aR,8aR,10S,11S,11aR,12aR,13aR)-1,13a-dihydroxy-11-isopropyl-4,7,8a-trimethyl-13-methylene-2-oxo-1,2,4,4a,5,7a,8,8a,9,10,11,11a,12,12a,13,13a-hexadecahydroindeno[5',6':4,5]cycloocta[1,2-c]pyran-10-yl 3-hydroxy-3,5-dimethylheptanoate |
| Synonyms | Source |
|---|---|
| YW 3548 | ChEBI |
| YW-3548 | ChEBI |
| Citations |
|---|