EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26ClN5O |
| Net Charge | 0 |
| Average Mass | 423.948 |
| Monoisotopic Mass | 423.18259 |
| SMILES | COc1nc2ccc(CN3CCN(C(=N)N)CC3)cc2cc1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H26ClN5O/c1-30-22-19(12-16-2-5-20(24)6-3-16)14-18-13-17(4-7-21(18)27-22)15-28-8-10-29(11-9-28)23(25)26/h2-7,13-14H,8-12,15H2,1H3,(H3,25,26) |
| InChIKey | MPNSEMULLQLQCF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BAR0329 (CHEBI:79384) has role antifungal agent (CHEBI:35718) |
| BAR0329 (CHEBI:79384) has role apoptosis inducer (CHEBI:68495) |
| BAR0329 (CHEBI:79384) is a aromatic ether (CHEBI:35618) |
| BAR0329 (CHEBI:79384) is a guanidines (CHEBI:24436) |
| BAR0329 (CHEBI:79384) is a monochlorobenzenes (CHEBI:83403) |
| BAR0329 (CHEBI:79384) is a piperazines (CHEBI:26144) |
| BAR0329 (CHEBI:79384) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| 4-{[3-(4-chlorobenzyl)-2-methoxyquinolin-6-yl]methyl}piperazine-1-carboximidamide |
| Citations |
|---|