EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26ClN5O |
| Net Charge | 0 |
| Average Mass | 423.948 |
| Monoisotopic Mass | 423.18259 |
| SMILES | COc1nc2ccc(CN3CCN(C(=N)N)CC3)cc2cc1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H26ClN5O/c1-30-22-19(12-16-2-5-20(24)6-3-16)14-18-13-17(4-7-21(18)27-22)15-28-8-10-29(11-9-28)23(25)26/h2-7,13-14H,8-12,15H2,1H3,(H3,25,26) |
| InChIKey | MPNSEMULLQLQCF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BAR0329 (CHEBI:79384) has role antifungal agent (CHEBI:35718) |
| BAR0329 (CHEBI:79384) has role apoptosis inducer (CHEBI:68495) |
| BAR0329 (CHEBI:79384) is a aromatic ether (CHEBI:35618) |
| BAR0329 (CHEBI:79384) is a guanidines (CHEBI:24436) |
| BAR0329 (CHEBI:79384) is a monochlorobenzenes (CHEBI:83403) |
| BAR0329 (CHEBI:79384) is a piperazines (CHEBI:26144) |
| BAR0329 (CHEBI:79384) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| 4-{[3-(4-chlorobenzyl)-2-methoxyquinolin-6-yl]methyl}piperazine-1-carboximidamide |
| Citations |
|---|