EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H41NO8 |
| Net Charge | 0 |
| Average Mass | 519.635 |
| Monoisotopic Mass | 519.28322 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCC[C@@H](O)CC(=O)O)[C@H](O)C[C@H]1OC(=O)c1cnc2ccccc12 |
| InChI | InChI=1S/C28H41NO8/c1-19-25(37-27(34)22-18-29-23-14-10-9-13-21(22)23)17-24(31)28(36-19)35-15-11-7-5-3-2-4-6-8-12-20(30)16-26(32)33/h9-10,13-14,18-20,24-25,28-31H,2-8,11-12,15-17H2,1H3,(H,32,33)/t19-,20+,24+,25+,28+/m0/s1 |
| InChIKey | FUIIPNLIVZGYJM-RHENGWIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8) and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibho#22 (CHEBI:79374) has functional parent (3R)-3,13-dihydroxytridecanoic acid (CHEBI:79279) |
| ibho#22 (CHEBI:79374) has functional parent bhos#22 (CHEBI:79261) |
| ibho#22 (CHEBI:79374) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ibho#22 (CHEBI:79374) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| ibho#22 (CHEBI:79374) is a 4-O-(1H-indol-3-ylcarbonyl)ascaroside (CHEBI:79024) |
| ibho#22 (CHEBI:79374) is a monocarboxylic acid (CHEBI:25384) |
| ibho#22 (CHEBI:79374) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| IUPAC Name |
|---|
| (3R)-13-{[3,6-dideoxy-4-O-(1H-indol-3-ylcarbonyl)-α-L-arabino-hexopyranosyl]oxy}-3-hydroxytridecanoic acid |
| Synonym | Source |
|---|---|
| 3R-hydroxy-13-(3'R-hydroxy-5'R-O-(1H-indol-3-ylcarbonyl)-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-tridecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| ibho%2322 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233520 | Reaxys |
| CAS:1355683-45-2 | SMID |
| Citations |
|---|