EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N2O12S3 |
| Net Charge | -1 |
| Average Mass | 527.531 |
| Monoisotopic Mass | 527.01056 |
| SMILES | O=S(=O)([O-])ON=C(Cc1cn(S(=O)(=O)O)c2ccccc12)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H20N2O12S3/c19-7-11-13(20)14(21)15(22)16(29-11)31-12(17-30-33(26,27)28)5-8-6-18(32(23,24)25)10-4-2-1-3-9(8)10/h1-4,6,11,13-16,19-22H,5,7H2,(H,23,24,25)(H,26,27,28)/p-1/t11-,13-,14+,15-,16+/m1/s1 |
| InChIKey | JZFQZINWXSEVSO-JZYAIQKZSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfoglucobrassicin(1−) (CHEBI:79365) is a indolylmethylglucosinolate (CHEBI:24796) |
| sulfoglucobrassicin(1−) (CHEBI:79365) is conjugate base of sulfoglucobrassicin (CHEBI:27842) |
| Incoming Relation(s) |
| sulfoglucobrassicin (CHEBI:27842) is conjugate acid of sulfoglucobrassicin(1−) (CHEBI:79365) |
| IUPAC Name |
|---|
| 1-S-[2-(1-sulfo-1H-indol-3-yl)-N-(sulfonatooxy)ethanimidoyl]-1-thio-β-D-glucopyranose |