EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H7Cl2NO3.C7H17NO5 |
| Net Charge | 0 |
| Average Mass | 503.335 |
| Monoisotopic Mass | 502.09097 |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(O)c1ccc2nc(-c3cc(Cl)cc(Cl)c3)oc2c1 |
| InChI | InChI=1S/C14H7Cl2NO3.C7H17NO5/c15-9-3-8(4-10(16)6-9)13-17-11-2-1-7(14(18)19)5-12(11)20-13;1-8-2-4(10)6(12)7(13)5(11)3-9/h1-6H,(H,18,19);4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChIKey | DQJDBUPLRMRBAB-WZTVWXICSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | central nervous system drug A class of drugs producing both physiological and psychological effects through a variety of mechanisms involving the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tafamidis meglumine (CHEBI:79345) has part tafamidis(1−) (CHEBI:79344) |
| tafamidis meglumine (CHEBI:79345) has role central nervous system drug (CHEBI:35470) |
| tafamidis meglumine (CHEBI:79345) is a organoammonium salt (CHEBI:46850) |
| IUPAC Names |
|---|
| 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylic acid—1-deoxy-1-(methylamino)-D-glucitol (1/1) |
| 1-deoxy-1-(methylazaniumyl)-D-glucitol 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
| Synonyms | Source |
|---|---|
| Fx-1006a | ChemIDplus |
| Fx1006A | ChemIDplus |
| Fx 1006A | ChemIDplus |
| Brand Name | Source |
|---|---|
| Vyndaqel | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D09674 | KEGG DRUG |
| WO2013038351 | Patent |
| Tafamidis | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23441785 | Reaxys |
| CAS:951395-08-7 | KEGG DRUG |
| CAS:951395-08-7 | ChemIDplus |
| Citations |
|---|