EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23NO9S2 |
| Net Charge | 0 |
| Average Mass | 389.448 |
| Monoisotopic Mass | 389.08142 |
| SMILES | CCCCC/C(=N/OS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H23NO9S2/c1-2-3-4-5-8(13-22-24(18,19)20)23-12-11(17)10(16)9(15)7(6-14)21-12/h7,9-12,14-17H,2-6H2,1H3,(H,18,19,20)/b13-8-/t7-,9-,10+,11-,12+/m1/s1 |
| InChIKey | HWFSIYKVSPYQJX-AHMUMSBHSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentylglucosinolic acid (CHEBI:79340) is a alkylglucosinolic acid (CHEBI:79327) |
| pentylglucosinolic acid (CHEBI:79340) is conjugate acid of pentylglucosinolate (CHEBI:36450) |
| Incoming Relation(s) |
| glucoalyssin (CHEBI:5395) has functional parent pentylglucosinolic acid (CHEBI:79340) |
| pentylglucosinolate (CHEBI:36450) is conjugate base of pentylglucosinolic acid (CHEBI:79340) |
| IUPAC Name |
|---|
| 1-S-[(1Z)-N-(sulfooxy)hexanimidoyl]-1-thio-β-D-glucopyranose |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23133612 | Reaxys |