EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H21NO9S2 |
| Net Charge | 0 |
| Average Mass | 375.421 |
| Monoisotopic Mass | 375.06577 |
| SMILES | CCCC/C(=N/OS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H21NO9S2/c1-2-3-4-7(12-21-23(17,18)19)22-11-10(16)9(15)8(14)6(5-13)20-11/h6,8-11,13-16H,2-5H2,1H3,(H,17,18,19)/b12-7-/t6-,8-,9+,10-,11+/m1/s1 |
| InChIKey | SYVVJZLOTVDBCP-IIPHORNXSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butylglucosinolic acid (CHEBI:79336) is a alkylglucosinolic acid (CHEBI:79327) |
| butylglucosinolic acid (CHEBI:79336) is conjugate acid of butylglucosinolate (CHEBI:36448) |
| Incoming Relation(s) |
| butylglucosinolate (CHEBI:36448) is conjugate base of butylglucosinolic acid (CHEBI:79336) |
| IUPAC Name |
|---|
| 1-S-[(1Z)-N-(sulfoxy)pentanimidoyl]-1-thio-β-D-glucopyranose |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23133611 | Reaxys |
| CAS:35535-42-3 | ChemIDplus |