EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H21NO9S2 |
| Net Charge | 0 |
| Average Mass | 375.421 |
| Monoisotopic Mass | 375.06577 |
| SMILES | CCC(C)/C(=N/OS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H21NO9S2/c1-3-5(2)10(12-21-23(17,18)19)22-11-9(16)8(15)7(14)6(4-13)20-11/h5-9,11,13-16H,3-4H2,1-2H3,(H,17,18,19)/b12-10-/t5?,6-,7-,8+,9-,11+/m1/s1 |
| InChIKey | TUSWQPFNQXCPGB-ANPCENJRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Armoracia rusticana (ncbitaxon:3704) | - | PubMed (22779710) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucocochlearin (CHEBI:79329) is a alkylglucosinolic acid (CHEBI:79327) |
| glucocochlearin (CHEBI:79329) is conjugate acid of glucocochlearin(1−) (CHEBI:5402) |
| Incoming Relation(s) |
| glucocochlearin(1−) (CHEBI:5402) is conjugate base of glucocochlearin (CHEBI:79329) |
| IUPAC Name |
|---|
| 1-S-[(1Z)-2-methyl-N-(sulfooxy)butanimidoyl]-1-thio-β-D-glucopyranose |
| Citations |
|---|