EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO9S2 |
| Net Charge | 0 |
| Average Mass | 333.340 |
| Monoisotopic Mass | 333.01882 |
| SMILES | C/C(=N/OS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H15NO9S2/c1-3(9-18-20(14,15)16)19-8-7(13)6(12)5(11)4(2-10)17-8/h4-8,10-13H,2H2,1H3,(H,14,15,16)/b9-3-/t4-,5-,6+,7-,8+/m1/s1 |
| InChIKey | UBTOEGCOMHAXGV-VECAIYLJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Peritoma arborea (ncbitaxon:171228) | - | PubMed (24307123) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucocapparin (CHEBI:79328) is a alkylglucosinolic acid (CHEBI:79327) |
| glucocapparin (CHEBI:79328) is conjugate acid of glucocapparin(1−) (CHEBI:5399) |
| Incoming Relation(s) |
| glucocapparin(1−) (CHEBI:5399) is conjugate base of glucocapparin (CHEBI:79328) |
| IUPAC Name |
|---|
| 1-S-[(1Z)-N-(sulfooxy)ethanimidoyl]-1-thio-β-D-glucopyranose |
| Synonym | Source |
|---|---|
| Methyl glucosinolate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C08404 | KEGG COMPOUND |
| HMDB0038429 | HMDB |
| C00001465 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:40997 | Reaxys |
| CAS:497-77-8 | KEGG COMPOUND |
| Citations |
|---|