EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H25NO9S3 |
| Net Charge | 0 |
| Average Mass | 435.542 |
| Monoisotopic Mass | 435.06914 |
| SMILES | CSCCCCC/C(=N/OS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H25NO9S3/c1-24-6-4-2-3-5-9(14-23-26(19,20)21)25-13-12(18)11(17)10(16)8(7-15)22-13/h8,10-13,15-18H,2-7H2,1H3,(H,19,20,21)/b14-9-/t8-,10-,11+,12-,13+/m1/s1 |
| InChIKey | MEFPHTVXBPLRLX-CBEPRAPJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aurinia (ncbitaxon:169390) | - | PubMed (24354202) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucoberteroin (CHEBI:79324) is a organic sulfide (CHEBI:16385) |
| glucoberteroin (CHEBI:79324) is a thia-alkylglucosinolic acid (CHEBI:79322) |
| glucoberteroin (CHEBI:79324) is conjugate acid of glucoberteroin(1−) (CHEBI:5396) |
| Incoming Relation(s) |
| glucoalyssin (CHEBI:5395) has functional parent glucoberteroin (CHEBI:79324) |
| glucoberteroin(1−) (CHEBI:5396) is conjugate base of glucoberteroin (CHEBI:79324) |
| IUPAC Name |
|---|
| 1-S-[(1Z)-6-(methylsulfanyl)-N-(sulfooxy)hexanimidoyl]-1-thio-β-D-glucopyranose |
| Synonym | Source |
|---|---|
| 5-Methylthiopentyl glucosinolate | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1441079 | Reaxys |
| CAS:29611-01-6 | ChemIDplus |
| CAS:29611-01-6 | KEGG COMPOUND |
| Citations |
|---|