EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:79312 - 18-hydroxyoleic acid
| Formula | C18H34O3 |
| Net Charge | 0 |
| Average Mass | 298.467 |
| Monoisotopic Mass | 298.25079 |
| SMILES | O=C(O)CCCCCCC/C=C\CCCCCCCCO |
| InChI | InChI=1S/C18H34O3/c19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(20)21/h1-2,19H,3-17H2,(H,20,21)/b2-1- |
| InChIKey | LQUHZVLTTWMBTO-UPHRSURJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-hydroxyoleic acid (CHEBI:79312) has functional parent oleic acid (CHEBI:16196) |
| 18-hydroxyoleic acid (CHEBI:79312) has role plant metabolite (CHEBI:76924) |
| 18-hydroxyoleic acid (CHEBI:79312) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| 18-hydroxyoleic acid (CHEBI:79312) is a straight-chain fatty acid (CHEBI:59202) |
| 18-hydroxyoleic acid (CHEBI:79312) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| 18-hydroxyoleic acid (CHEBI:79312) is conjugate acid of 18-hydroxyoleate (CHEBI:78424) |
| Incoming Relation(s) |
| (9Z)-18-hydroxyoctadec-9-enoic acid 18-O-sophoroside (CHEBI:229691) has functional parent 18-hydroxyoleic acid (CHEBI:79312) |
| (9Z)-18-hydroxyoctadec-9-enoic acid 18-O-β-D-glucoside (CHEBI:144844) has functional parent 18-hydroxyoleic acid (CHEBI:79312) |
| 18-hydroxyoleate (CHEBI:78424) is conjugate base of 18-hydroxyoleic acid (CHEBI:79312) |
| IUPAC Name |
|---|
| (9Z)-18-hydroxyoctadec-9-enoic acid |
| Synonyms | Source |
|---|---|
| (9Z)-18-hydroxyoctadecenoic acid | ChEBI |
| ω-hydroxy-(9Z)-octadecenoic acid | ChEBI |
| ω-hydroxyoleic acid | ChEBI |
| 18-hydroxy-9Z-octadecenoic acid | LIPID MAPS |
| 19-HOME(9Z) | LIPID MAPS |
| 18-Hydroxy-9-octadecenoic acid | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C19616 | KEGG COMPOUND |
| LMFA02000181 | LIPID MAPS |
| C00007439 | KNApSAcK |
| 18-HYDROXYOLEATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1712247 | Reaxys |
| Citations |
|---|