EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13ClN4 |
| Net Charge | 0 |
| Average Mass | 284.750 |
| Monoisotopic Mass | 284.08287 |
| SMILES | Cc1ccc(Nc2nc(N)c3ccccc3n2)cc1Cl |
| InChI | InChI=1S/C15H13ClN4/c1-9-6-7-10(8-12(9)16)18-15-19-13-5-3-2-4-11(13)14(17)20-15/h2-8H,1H3,(H3,17,18,19,20) |
| InChIKey | LFMFPKKYRXFHHZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| Application: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| R24 (CHEBI:79310) has role immunomodulator (CHEBI:50846) |
| R24 (CHEBI:79310) is a monochlorobenzenes (CHEBI:83403) |
| R24 (CHEBI:79310) is a primary amino compound (CHEBI:50994) |
| R24 (CHEBI:79310) is a quinazolines (CHEBI:38530) |
| R24 (CHEBI:79310) is a secondary amino compound (CHEBI:50995) |
| R24 (CHEBI:79310) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| N2-(3-chloro-4-methylphenyl)quinazoline-2,4-diamine |
| Synonyms | Source |
|---|---|
| 2-N-(3-chloro-4-methylphenyl) quinazoline-2,4-diamine | ChEBI |
| RPW-24 | ChEBI |
| Citations |
|---|