EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28N4O6 |
| Net Charge | 0 |
| Average Mass | 432.477 |
| Monoisotopic Mass | 432.20088 |
| SMILES | Cc1c(CC(=O)NCCCC[C@H](NC(=O)CCN)C(=O)O)c(=O)oc2cc(N)ccc12 |
| InChI | InChI=1S/C21H28N4O6/c1-12-14-6-5-13(23)10-17(14)31-21(30)15(12)11-19(27)24-9-3-2-4-16(20(28)29)25-18(26)7-8-22/h5-6,10,16H,2-4,7-9,11,22-23H2,1H3,(H,24,27)(H,25,26)(H,28,29)/t16-/m0/s1 |
| InChIKey | BXZFTTVQAOLWHY-INIZCTEOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | fluorescent probe A role played by a fluorescent molecular entity used to study the microscopic environment by fluorescence spectroscopy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-Ala-Lys-Nε-AMCA (CHEBI:79309) has role fluorescent probe (CHEBI:39442) |
| β-Ala-Lys-Nε-AMCA (CHEBI:79309) is a 7-aminocoumarins (CHEBI:51769) |
| β-Ala-Lys-Nε-AMCA (CHEBI:79309) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| β-alanyl-N6-[(7-amino-4-methyl-2-oxo-2H-chromen-3-yl)acetyl]-L-lysine |
| Synonyms | Source |
|---|---|
| β-Ala-Lys(AMCA) | ChEBI |
| β-Ala-Lys-N6-AMCA | ChEBI |
| Citations |
|---|