EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13N |
| Net Charge | 0 |
| Average Mass | 159.232 |
| Monoisotopic Mass | 159.10480 |
| SMILES | C#CCN(C)Cc1ccccc1 |
| InChI | InChI=1S/C11H13N/c1-3-9-12(2)10-11-7-5-4-6-8-11/h1,4-8H,9-10H2,2H3 |
| InChIKey | DPWPWRLQFGFJFI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pargyline (CHEBI:7930) has role antihypertensive agent (CHEBI:35674) |
| Pargyline (CHEBI:7930) is a aromatic amine (CHEBI:33860) |
| INN | Source |
|---|---|
| pargilina | WHO MedNet |
| Synonyms | Source |
|---|---|
| eutonyl | DrugCentral |
| Eutron | ChEMBL |
| N-Methyl-N-benzylpropynylamine | DrugCentral |
| pargylamine | DrugCentral |
| pargylin | DrugCentral |
| Pargyline | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2065 | DrugCentral |
| C07414 | KEGG COMPOUND |
| D08453 | KEGG DRUG |
| HMDB0015563 | HMDB |
| LSM-3878 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:555-57-7 | KEGG COMPOUND |
| Citations |
|---|