EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H44O4 |
| Net Charge | 0 |
| Average Mass | 372.590 |
| Monoisotopic Mass | 372.32396 |
| SMILES | O=C(O)C[C@H](O)CCCCCCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C22H44O4/c23-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-21(24)20-22(25)26/h21,23-24H,1-20H2,(H,25,26)/t21-/m1/s1 |
| InChIKey | IHEWAAVRGMOJHH-OAQYLSRUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-3,22-dihydroxybehenic acid (CHEBI:79298) has functional parent docosanoic acid (CHEBI:28941) |
| (3R)-3,22-dihydroxybehenic acid (CHEBI:79298) is a (3R)-3-hydroxy fatty acid (CHEBI:85678) |
| (3R)-3,22-dihydroxybehenic acid (CHEBI:79298) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| (3R)-3,22-dihydroxybehenic acid (CHEBI:79298) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| Incoming Relation(s) |
| bhos#40 (CHEBI:79270) has functional parent (3R)-3,22-dihydroxybehenic acid (CHEBI:79298) |
| IUPAC Name |
|---|
| (3R)-3,22-dihydroxydocosanoic acid |