EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H55NO16 |
| Net Charge | 0 |
| Average Mass | 829.893 |
| Monoisotopic Mass | 829.35208 |
| SMILES | CC[C@@]1(O)C[C@H](O[C@H]2C[C@H](N(C)C)[C@H](O[C@H]3C[C@H](O)[C@H](O[C@H]4C[C@H](O)[C@H](O)[C@H](C)O4)[C@H](C)O3)[C@H](C)O2)c2c(cc3c(c2O)C(=O)c2c(O)cccc2C3=O)[C@H]1C(=O)OC |
| InChI | InChI=1S/C42H55NO16/c1-8-42(52)16-27(32-21(34(42)41(51)53-7)12-22-33(38(32)50)37(49)31-20(36(22)48)10-9-11-24(31)44)57-28-13-23(43(5)6)39(18(3)55-28)58-30-15-26(46)40(19(4)56-30)59-29-14-25(45)35(47)17(2)54-29/h9-12,17-19,23,25-30,34-35,39-40,44-47,50,52H,8,13-16H2,1-7H3/t17-,18-,19-,23-,25-,26-,27-,28-,29-,30-,34-,35+,39+,40+,42+/m0/s1 |
| InChIKey | DEGUCPPGAZTULS-UJSHPDKWSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-deoxy-α-L-fucosylaclacinomycin S (CHEBI:79297) has functional parent aklavinone (CHEBI:31181) |
| 2-deoxy-α-L-fucosylaclacinomycin S (CHEBI:79297) has role metabolite (CHEBI:25212) |
| 2-deoxy-α-L-fucosylaclacinomycin S (CHEBI:79297) is a p-quinones (CHEBI:25830) |
| 2-deoxy-α-L-fucosylaclacinomycin S (CHEBI:79297) is a aminoglycoside (CHEBI:47779) |
| 2-deoxy-α-L-fucosylaclacinomycin S (CHEBI:79297) is a anthracycline (CHEBI:48120) |
| 2-deoxy-α-L-fucosylaclacinomycin S (CHEBI:79297) is a methyl ester (CHEBI:25248) |
| 2-deoxy-α-L-fucosylaclacinomycin S (CHEBI:79297) is a phenols (CHEBI:33853) |
| 2-deoxy-α-L-fucosylaclacinomycin S (CHEBI:79297) is a polyketide (CHEBI:26188) |
| 2-deoxy-α-L-fucosylaclacinomycin S (CHEBI:79297) is a trisaccharide derivative (CHEBI:63571) |
| 2-deoxy-α-L-fucosylaclacinomycin S (CHEBI:79297) is tautomer of 2-deoxy-α-L-fucosylaclacinomycin S zwitterion (CHEBI:78378) |
| Incoming Relation(s) |
| 2-deoxy-α-L-fucosylaclacinomycin S zwitterion (CHEBI:78378) is tautomer of 2-deoxy-α-L-fucosylaclacinomycin S (CHEBI:79297) |
| IUPAC Name |
|---|
| methyl (R,2R,4S)-4-{[2,6-dideoxy-α-L-lyxo-hexopyranosyl-(1→4)-2,6-dideoxy-α-L-lyxo-hexopyranosyl-(1→4)-2,3,6-trideoxy-3-(dimethylamino)-α-L-lyxo-hexopyranosyl]oxy}-2-ethyl-2,5,7-trihydroxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracene-1-carboxylate |
| Synonym | Source |
|---|---|
| 2-deoxy-L-fucosyl-(1→4)-2-deoxy-L-fucosyl-(1→4)-L-rhodosaminyl-(1→4')-aklavinone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11218075 | Reaxys |
| Citations |
|---|