EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8N4O4 |
| Net Charge | 0 |
| Average Mass | 248.198 |
| Monoisotopic Mass | 248.05455 |
| SMILES | NC1=C/C(=C2/C=C(N)C(=O)NC2=O)C(=O)NC1=O |
| InChI | InChI=1S/C10H8N4O4/c11-5-1-3(7(15)13-9(5)17)4-2-6(12)10(18)14-8(4)16/h1-2H,11-12H2,(H,13,15,17)(H,14,16,18)/b4-3+ |
| InChIKey | ALDIVIWLBSDGGN-ONEGZZNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces lavendulae (ncbitaxon:1914) | - | PubMed (17237222) | Strain: ATCC11924 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indigoidine (CHEBI:79296) has functional parent L-glutamine (CHEBI:18050) |
| indigoidine (CHEBI:79296) has role bacterial metabolite (CHEBI:76969) |
| indigoidine (CHEBI:79296) has role biological pigment (CHEBI:26130) |
| indigoidine (CHEBI:79296) is a dicarboximide (CHEBI:35356) |
| indigoidine (CHEBI:79296) is a enamine (CHEBI:47989) |
| indigoidine (CHEBI:79296) is a pyridone (CHEBI:38183) |
| indigoidine (CHEBI:79296) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| (3E)-5-amino-3-(5-amino-2,6-dioxo-1,6-dihydropyridin-3(2H)-ylidene)pyridine-2,6(1H,3H)-dione |
| Synonym | Source |
|---|---|
| 5,5'-diamino-4,4'-dihydroxy-3,3'-diazadiphenoquinone-(2,2') | SUBMITTER |
| UniProt Name | Source |
|---|---|
| indigoidine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:621302 | Reaxys |
| CAS:2435-59-8 | ChemIDplus |
| Citations |
|---|