EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38O7 |
| Net Charge | 0 |
| Average Mass | 390.517 |
| Monoisotopic Mass | 390.26175 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCCC[C@@H](O)CC(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H38O7/c1-15-17(22)14-18(23)20(27-15)26-12-10-8-6-4-2-3-5-7-9-11-16(21)13-19(24)25/h15-18,20-23H,2-14H2,1H3,(H,24,25)/t15-,16+,17+,18+,20+/m0/s1 |
| InChIKey | OEUPNEHVNNGMKN-VAVNGKDRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8) and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhos#24 (CHEBI:79262) has functional parent (3R)-3,14-dihydroxymyristic acid (CHEBI:79281) |
| bhos#24 (CHEBI:79262) has functional parent oscr#24 (CHEBI:79146) |
| bhos#24 (CHEBI:79262) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| bhos#24 (CHEBI:79262) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| bhos#24 (CHEBI:79262) is a monocarboxylic acid (CHEBI:25384) |
| bhos#24 (CHEBI:79262) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| bhos#24 (CHEBI:79262) is conjugate acid of bhos#24(1-) (CHEBI:139799) |
| Incoming Relation(s) |
| ibho#24 (CHEBI:79375) has functional parent bhos#24 (CHEBI:79262) |
| bhos#24(1-) (CHEBI:139799) is conjugate base of bhos#24 (CHEBI:79262) |
| IUPAC Name |
|---|
| (3R)-14-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxytetradecanoic acid |
| Synonyms | Source |
|---|---|
| 3R-hydroxy-14-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-tetradecanoic acid | SMID |
| (3R)-14-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxymyristic acid | ChEBI |
| 3R-hydroxy-14-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-myristic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| bhos%2324%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233446 | Reaxys |
| CAS:1355682-80-2 | SMID |
| Citations |
|---|