EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H46O4 |
| Net Charge | 0 |
| Average Mass | 386.617 |
| Monoisotopic Mass | 386.33961 |
| SMILES | C[C@@H](O)CCCCCCCCCCCCCCCCCC[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C23H46O4/c1-21(24)18-16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-19-22(25)20-23(26)27/h21-22,24-25H,2-20H2,1H3,(H,26,27)/t21-,22-/m1/s1 |
| InChIKey | REKJIYYOAJFPLI-FGZHOGPDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,22R)-3,22-dihydroxytricosanoic acid (CHEBI:79255) has functional parent tricosanoic acid (CHEBI:42394) |
| (3R,22R)-3,22-dihydroxytricosanoic acid (CHEBI:79255) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| (3R,22R)-3,22-dihydroxytricosanoic acid (CHEBI:79255) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| (3R,22R)-3,22-dihydroxytricosanoic acid (CHEBI:79255) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| (3R,22R)-3,22-dihydroxytricosanoic acid (CHEBI:79255) is a very long-chain fatty acid (CHEBI:27283) |
| Incoming Relation(s) |
| bhas#42 (CHEBI:79241) has functional parent (3R,22R)-3,22-dihydroxytricosanoic acid (CHEBI:79255) |
| IUPAC Name |
|---|
| (3R,22R)-3,22-dihydroxytricosanoic acid |
| Synonym | Source |
|---|---|
| (R,R)-3,22-dihydroxytricosanoic acid | ChEBI |