EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H54O7 |
| Net Charge | 0 |
| Average Mass | 502.733 |
| Monoisotopic Mass | 502.38695 |
| SMILES | C[C@H](CCCCCCCCCCCCCCCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C28H54O7/c1-22(34-28-26(31)21-25(30)23(2)35-28)18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-24(29)20-27(32)33/h22-26,28-31H,3-21H2,1-2H3,(H,32,33)/t22-,23+,24-,25-,26-,28-/m1/s1 |
| InChIKey | KNOOLMWLZZIQFQ-CWEZWLNASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8), daf-22(ok693), and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhas#40 (CHEBI:79240) has functional parent (3R,21R)-3,21-dihydroxybehenic acid (CHEBI:79254) |
| bhas#40 (CHEBI:79240) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| bhas#40 (CHEBI:79240) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| bhas#40 (CHEBI:79240) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| bhas#40 (CHEBI:79240) is a monocarboxylic acid (CHEBI:25384) |
| Manual Xrefs | Databases |
|---|---|
| bhas%2340%0D | SMID |
| Citations |
|---|