EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H52O7 |
| Net Charge | 0 |
| Average Mass | 488.706 |
| Monoisotopic Mass | 488.37130 |
| SMILES | C[C@H](CCCCCCCCCCCCCCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C27H52O7/c1-21(33-27-25(30)20-24(29)22(2)34-27)17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-23(28)19-26(31)32/h21-25,27-30H,3-20H2,1-2H3,(H,31,32)/t21-,22+,23-,24-,25-,27-/m1/s1 |
| InChIKey | LONSJLDZLUHCRR-LJNMJUOLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22235948) | A major ascaroside in dhs-28(hj8) and daf-22(ok693) mutant worms, also detected in maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhas#38 (CHEBI:79239) has functional parent (3R,20R)-3,20-dihydroxyhenicosanoic acid (CHEBI:79253) |
| bhas#38 (CHEBI:79239) has functional parent ascr#38 (CHEBI:78976) |
| bhas#38 (CHEBI:79239) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| bhas#38 (CHEBI:79239) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| bhas#38 (CHEBI:79239) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| bhas#38 (CHEBI:79239) is a monocarboxylic acid (CHEBI:25384) |
| bhas#38 (CHEBI:79239) is conjugate acid of bhas#38(1-) (CHEBI:139765) |
| Incoming Relation(s) |
| bhas#38(1-) (CHEBI:139765) is conjugate base of bhas#38 (CHEBI:79239) |
| IUPAC Name |
|---|
| (3R,20R)-20-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxyhenicosanoic acid |
| Synonyms | Source |
|---|---|
| (3R,20R)-20-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxyheneicosanoic acid | ChEBI |
| 3R-hydroxy-20R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-henicosanoic acid | SMID |
| 3R-hydroxy-20R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-heneicosanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| bhas%2338%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233521 | Reaxys |
| CAS:1355682-70-0 | SMID |
| Citations |
|---|