EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H46O7 |
| Net Charge | 0 |
| Average Mass | 446.625 |
| Monoisotopic Mass | 446.32435 |
| SMILES | C[C@H](CCCCCCCCCCCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C24H46O7/c1-18(30-24-22(27)17-21(26)19(2)31-24)14-12-10-8-6-4-3-5-7-9-11-13-15-20(25)16-23(28)29/h18-22,24-27H,3-17H2,1-2H3,(H,28,29)/t18-,19+,20-,21-,22-,24-/m1/s1 |
| InChIKey | FHMZFRKIYGFIOX-RQOGSKLQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Found in dhs-28(hj8), daf-22(ok693), maoc-1(hj13), and acox-1(ok2257) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhas#32 (CHEBI:79236) has functional parent (R,R)-3,17-dihydroxyoctadecanoic acid (CHEBI:79250) |
| bhas#32 (CHEBI:79236) has functional parent ascr#32 (CHEBI:78970) |
| bhas#32 (CHEBI:79236) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| bhas#32 (CHEBI:79236) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| bhas#32 (CHEBI:79236) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| bhas#32 (CHEBI:79236) is a monocarboxylic acid (CHEBI:25384) |
| bhas#32 (CHEBI:79236) is conjugate acid of bhas#32(1-) (CHEBI:139756) |
| Incoming Relation(s) |
| bhas#32(1-) (CHEBI:139756) is conjugate base of bhas#32 (CHEBI:79236) |
| IUPAC Name |
|---|
| (3R,17R)-17-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxyoctadecanoic acid |
| Synonyms | Source |
|---|---|
| 3R-hydroxy-17R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-octadecanoic acid | SMID |
| (3R,17R)-17-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxystearic acid | ChEBI |
| 3R-hydroxy-17R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-stearic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| bhas%2332%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233494 | Reaxys |
| CAS:1355682-64-2 | SMID |
| Citations |
|---|