EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6O4S |
| Net Charge | 0 |
| Average Mass | 138.144 |
| Monoisotopic Mass | 137.99868 |
| SMILES | O=C(O)CCS(=O)O |
| InChI | InChI=1S/C3H6O4S/c4-3(5)1-2-8(6)7/h1-2H2,(H,4,5)(H,6,7) |
| InChIKey | GBHSTQUVJWQJOK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-sulfinopropionic acid (CHEBI:79222) is a monocarboxylic acid (CHEBI:25384) |
| 3-sulfinopropionic acid (CHEBI:79222) is a organosulfinic acid (CHEBI:37783) |
| 3-sulfinopropionic acid (CHEBI:79222) is conjugate acid of 3-sulfinatopropionate (CHEBI:137673) |
| Incoming Relation(s) |
| 3-sulfinopropionyl-CoA (CHEBI:79221) has functional parent 3-sulfinopropionic acid (CHEBI:79222) |
| 3-sulfinatopropionate (CHEBI:137673) is conjugate base of 3-sulfinopropionic acid (CHEBI:79222) |
| IUPAC Name |
|---|
| 3-sulfinopropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-16584 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1759839 | Reaxys |
| Citations |
|---|