EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19NO3 |
| Net Charge | 0 |
| Average Mass | 249.310 |
| Monoisotopic Mass | 249.13649 |
| SMILES | CC(C)=CCOc1ccc(C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C14H19NO3/c1-10(2)7-8-18-12-5-3-11(4-6-12)9-13(15)14(16)17/h3-7,13H,8-9,15H2,1-2H3,(H,16,17)/t13-/m0/s1 |
| InChIKey | DVPQPQUTSYCKEZ-ZDUSSCGKSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-O-dimethylallyl-L-tyrosine (CHEBI:79185) is a L-tyrosine derivative (CHEBI:27177) |
| 4-O-dimethylallyl-L-tyrosine (CHEBI:79185) is tautomer of 4-O-dimethylallyl-L-tyrosine zwitterion (CHEBI:78314) |
| Incoming Relation(s) |
| 4-O-dimethylallyl-L-tyrosine zwitterion (CHEBI:78314) is tautomer of 4-O-dimethylallyl-L-tyrosine (CHEBI:79185) |
| IUPAC Name |
|---|
| O-(3-methylbut-2-en-1-yl)-L-tyrosine |
| Synonyms | Source |
|---|---|
| 4-O-prenyl-L-tyrosine | ChEBI |
| O-prenyl-L-tyrosine | ChEBI |
| O-prenyltyrosine | ChEBI |
| O-dimethylallyl-L-tyrosine | ChEBI |
| O-dimethylallyltyrosine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-16653 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11092753 | Reaxys |