EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15F2N3O4S |
| Net Charge | 0 |
| Average Mass | 383.376 |
| Monoisotopic Mass | 383.07513 |
| SMILES | COc1ccnc(CS(=O)c2nc3ccc(OC(F)F)cc3n2)c1OC |
| InChI | InChI=1S/C16H15F2N3O4S/c1-23-13-5-6-19-12(14(13)24-2)8-26(22)16-20-10-4-3-9(25-15(17)18)7-11(10)21-16/h3-7,15H,8H2,1-2H3,(H,20,21) |
| InChIKey | IQPSEEYGBUAQFF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that inhibits H+/K+-exchanging ATPase, EC 3.6.3.10. Such compounds are also known as proton pump inhibitors. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pantoprazole (CHEBI:7915) has role anti-ulcer drug (CHEBI:49201) |
| pantoprazole (CHEBI:7915) has role EC 3.6.3.10 (H+/K+-exchanging ATPase) inhibitor (CHEBI:49200) |
| pantoprazole (CHEBI:7915) has role environmental contaminant (CHEBI:78298) |
| pantoprazole (CHEBI:7915) has role xenobiotic (CHEBI:35703) |
| pantoprazole (CHEBI:7915) is a aromatic ether (CHEBI:35618) |
| pantoprazole (CHEBI:7915) is a benzimidazoles (CHEBI:22715) |
| pantoprazole (CHEBI:7915) is a organofluorine compound (CHEBI:37143) |
| pantoprazole (CHEBI:7915) is a pyridines (CHEBI:26421) |
| pantoprazole (CHEBI:7915) is a sulfoxide (CHEBI:22063) |
| pantoprazole (CHEBI:7915) is conjugate acid of pantoprazole(1−) (CHEBI:50358) |
| Incoming Relation(s) |
| pantoprazole(1−) (CHEBI:50358) is conjugate base of pantoprazole (CHEBI:7915) |
| IUPAC Name |
|---|
| 5-(difluoromethoxy)-2-{[(3,4-dimethoxypyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole |
| INNs | Source |
|---|---|
| pantoprazol | ChemIDplus |
| pantoprazole | ChemIDplus |
| pantoprazolum | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2054 | DrugCentral |
| 2958 | VSDB |
| C11806 | KEGG COMPOUND |
| D05353 | KEGG DRUG |
| DB00213 | DrugBank |
| EP166287 | Patent |
| HMDB0005017 | HMDB |
| LSM-1390 | LINCS |
| Pantoprazole | Wikipedia |
| US4758579 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5361474 | Reaxys |
| CAS:102625-70-7 | ChemIDplus |
| Citations |
|---|