EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15F2N3O4S |
| Net Charge | 0 |
| Average Mass | 383.376 |
| Monoisotopic Mass | 383.07513 |
| SMILES | COc1ccnc(CS(=O)c2nc3ccc(OC(F)F)cc3n2)c1OC |
| InChI | InChI=1S/C16H15F2N3O4S/c1-23-13-5-6-19-12(14(13)24-2)8-26(22)16-20-10-4-3-9(25-15(17)18)7-11(10)21-16/h3-7,15H,8H2,1-2H3,(H,20,21) |
| InChIKey | IQPSEEYGBUAQFF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. EC 3.6.3.10 (H(+)/K(+)-exchanging ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that inhibits H+/K+-exchanging ATPase, EC 3.6.3.10. Such compounds are also known as proton pump inhibitors. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. hypoglycemic agent A drug which lowers the blood glucose level. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pantoprazole (CHEBI:7915) has role anti-ulcer drug (CHEBI:49201) |
| pantoprazole (CHEBI:7915) has role antibacterial agent (CHEBI:33282) |
| pantoprazole (CHEBI:7915) has role antifungal agent (CHEBI:35718) |
| pantoprazole (CHEBI:7915) has role antineoplastic agent (CHEBI:35610) |
| pantoprazole (CHEBI:7915) has role antipsychotic agent (CHEBI:35476) |
| pantoprazole (CHEBI:7915) has role cardiovascular drug (CHEBI:35554) |
| pantoprazole (CHEBI:7915) has role EC 3.6.3.10 (H+/K+-exchanging ATPase) inhibitor (CHEBI:49200) |
| pantoprazole (CHEBI:7915) has role environmental contaminant (CHEBI:78298) |
| pantoprazole (CHEBI:7915) has role hypoglycemic agent (CHEBI:35526) |
| pantoprazole (CHEBI:7915) has role immunosuppressive agent (CHEBI:35705) |
| pantoprazole (CHEBI:7915) has role xenobiotic (CHEBI:35703) |
| pantoprazole (CHEBI:7915) is a aromatic ether (CHEBI:35618) |
| pantoprazole (CHEBI:7915) is a benzimidazoles (CHEBI:22715) |
| pantoprazole (CHEBI:7915) is a organofluorine compound (CHEBI:37143) |
| pantoprazole (CHEBI:7915) is a pyridines (CHEBI:26421) |
| pantoprazole (CHEBI:7915) is a sulfoxide (CHEBI:22063) |
| pantoprazole (CHEBI:7915) is conjugate acid of pantoprazole(1−) (CHEBI:50358) |
| Incoming Relation(s) |
| pantoprazole(1−) (CHEBI:50358) is conjugate base of pantoprazole (CHEBI:7915) |
| IUPAC Name |
|---|
| 5-(difluoromethoxy)-2-{[(3,4-dimethoxypyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole |
| INNs | Source |
|---|---|
| pantoprazol | ChemIDplus |
| pantoprazole | ChemIDplus |
| pantoprazolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Altopan | ChEMBL |
| BY 1023 | ChEMBL |
| BY-1023 | ChEMBL |
| BY1023 | ChEMBL |
| NSC-759257 | ChEMBL |
| Pantocid | ChEMBL |
| Brand Name | Source |
|---|---|
| Protium i.v. | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2054 | DrugCentral |
| 2958 | VSDB |
| C11806 | KEGG COMPOUND |
| D05353 | KEGG DRUG |
| DB00213 | DrugBank |
| EP166287 | Patent |
| HMDB0005017 | HMDB |
| LSM-1390 | LINCS |
| Pantoprazole | Wikipedia |
| US4758579 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5361474 | Reaxys |
| CAS:102625-70-7 | ChemIDplus |
| Citations |
|---|