EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O4 |
| Net Charge | 0 |
| Average Mass | 232.235 |
| Monoisotopic Mass | 232.07356 |
| SMILES | COc1cc(C)c2ccc(O)c(C(=O)O)c2c1 |
| InChI | InChI=1S/C13H12O4/c1-7-5-8(17-2)6-10-9(7)3-4-11(14)12(10)13(15)16/h3-6,14H,1-2H3,(H,15,16) |
| InChIKey | LYGUXQMPYLCEGL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-7-methoxy-5-methyl-1-naphthoic acid (CHEBI:79125) has role bacterial metabolite (CHEBI:76969) |
| 2-hydroxy-7-methoxy-5-methyl-1-naphthoic acid (CHEBI:79125) is a methoxynaphthalene (CHEBI:48851) |
| 2-hydroxy-7-methoxy-5-methyl-1-naphthoic acid (CHEBI:79125) is a naphthoic acid (CHEBI:25483) |
| 2-hydroxy-7-methoxy-5-methyl-1-naphthoic acid (CHEBI:79125) is a naphthols (CHEBI:25392) |
| Incoming Relation(s) |
| 2-hydroxy-7-methoxy-5-methyl-1-naphthoyl-CoA (CHEBI:79293) has functional parent 2-hydroxy-7-methoxy-5-methyl-1-naphthoic acid (CHEBI:79125) |
| IUPAC Name |
|---|
| 2-hydroxy-7-methoxy-5-methyl-1-naphthoic acid |
| Synonym | Source |
|---|---|
| 2-hydroxy-7-methoxy-5-methylnaphthalene-1-carboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-16519 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4439261 | Reaxys |
| Citations |
|---|