EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H35NO7 |
| Net Charge | 0 |
| Average Mass | 461.555 |
| Monoisotopic Mass | 461.24135 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCC(=O)O)[C@H](O)C[C@H]1OC(=O)c1cnc2ccccc12 |
| InChI | InChI=1S/C25H35NO7/c1-17-22(33-24(30)19-16-26-20-12-9-8-11-18(19)20)15-21(27)25(32-17)31-14-10-6-4-2-3-5-7-13-23(28)29/h8-9,11-12,16-17,21-22,25-27H,2-7,10,13-15H2,1H3,(H,28,29)/t17-,21+,22+,25+/m0/s1 |
| InChIKey | FVKMIXWYNVQFGG-DZBFJFRRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8), acox-1(ok2257), and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icos#16 (CHEBI:79119) has functional parent 10-hydroxycapric acid (CHEBI:17409) |
| icos#16 (CHEBI:79119) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| icos#16 (CHEBI:79119) is a 4-O-(1H-indol-3-ylcarbonyl)ascaroside (CHEBI:79024) |
| icos#16 (CHEBI:79119) is a monocarboxylic acid (CHEBI:25384) |
| icos#16 (CHEBI:79119) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| IUPAC Name |
|---|
| 10-{[3,6-dideoxy-4-O-(1H-indol-3-ylcarbonyl)-α-L-arabino-hexopyranosyl]oxy}decanoic acid |
| Synonym | Source |
|---|---|
| 10-(3'R-hydroxy-5'R-O-(1H-indol-3-ylcarbonyl)-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-decanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| icos%2316%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233471 | Reaxys |
| CAS:1355683-15-6 | SMID |
| Citations |
|---|