EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O15 |
| Net Charge | 0 |
| Average Mass | 594.522 |
| Monoisotopic Mass | 594.15847 |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c12 |
| InChI | InChI=1S/C27H30O15/c28-5-11-17(32)21(36)23(38)26(41-11)14-19(34)13-16(31)10(8-1-3-9(30)4-2-8)7-40-25(13)15(20(14)35)27-24(39)22(37)18(33)12(6-29)42-27/h1-4,7,11-12,17-18,21-24,26-30,32-39H,5-6H2/t11-,12-,17-,18-,21+,22+,23-,24-,26+,27+/m1/s1 |
| InChIKey | ISNRVVKKHPECQN-BOLWDHOCSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paniculatin (CHEBI:7910) has functional parent isoflavone (CHEBI:18220) |
| paniculatin (CHEBI:7910) has role plant metabolite (CHEBI:76924) |
| paniculatin (CHEBI:7910) is a C-glycosyl compound (CHEBI:20857) |
| paniculatin (CHEBI:7910) is a hydroxyisoflavone (CHEBI:38755) |
| Manual Xrefs | Databases |
|---|---|
| C00002557 | KNApSAcK |
| C10513 | KEGG COMPOUND |
| LMPK12050162 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5210257 | Reaxys |
| CAS:32361-88-9 | ChemIDplus |
| CAS:32361-88-9 | KEGG COMPOUND |
| Citations |
|---|