EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14FN3O |
| Net Charge | 0 |
| Average Mass | 331.350 |
| Monoisotopic Mass | 331.11209 |
| SMILES | Oc1ccc(-c2nc(-c3ccncc3)c(-c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C20H14FN3O/c21-16-5-1-13(2-6-16)18-19(14-9-11-22-12-10-14)24-20(23-18)15-3-7-17(25)8-4-15/h1-12,25H,(H,23,24) |
| InChIKey | QHKYPYXTTXKZST-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SB-202190 (CHEBI:79090) has role apoptosis inducer (CHEBI:68495) |
| SB-202190 (CHEBI:79090) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| SB-202190 (CHEBI:79090) is a imidazoles (CHEBI:24780) |
| SB-202190 (CHEBI:79090) is a organofluorine compound (CHEBI:37143) |
| SB-202190 (CHEBI:79090) is a phenols (CHEBI:33853) |
| SB-202190 (CHEBI:79090) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 4-[4-(4-fluorophenyl)-5-(pyridin-4-yl)-1H-imidazol-2-yl]phenol |
| Synonyms | Source |
|---|---|
| SB 202190 | ChemIDplus |
| SB202190 | ChEBI |
| 4-(4-fluorophenyl)-2-(4-hydroxyphenyl)-5-(4-pyridyl)imidazole | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10467168 | Reaxys |
| CAS:152121-30-7 | ChemIDplus |
| Citations |
|---|