EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H22O10 |
| Net Charge | 0 |
| Average Mass | 566.518 |
| Monoisotopic Mass | 566.12130 |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)cc(O)c(-c4cc(-c5cc(=O)c6c(O)cc(O)cc6o5)ccc4OC)c3o2)cc1 |
| InChI | InChI=1S/C32H22O10/c1-39-18-6-3-15(4-7-18)26-14-24(38)31-22(36)12-21(35)29(32(31)42-26)19-9-16(5-8-25(19)40-2)27-13-23(37)30-20(34)10-17(33)11-28(30)41-27/h3-14,33-36H,1-2H3 |
| InChIKey | HUOOMAOYXQFIDQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.24.35 (gelatinase B) inhibitor An EC 3.4.24.* (metalloendopeptidase) inhibitor that interferes with the action of gelatinase B (EC 3.4.24.35). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoginkgetin (CHEBI:79087) has functional parent 5,7-dihydroxy-4'-methoxyflavone (CHEBI:15335) |
| isoginkgetin (CHEBI:79087) has role antineoplastic agent (CHEBI:35610) |
| isoginkgetin (CHEBI:79087) has role EC 3.4.24.35 (gelatinase B) inhibitor (CHEBI:79088) |
| isoginkgetin (CHEBI:79087) has role plant metabolite (CHEBI:76924) |
| isoginkgetin (CHEBI:79087) is a aromatic ether (CHEBI:35618) |
| isoginkgetin (CHEBI:79087) is a biflavonoid (CHEBI:50128) |
| IUPAC Name |
|---|
| 8-[5-(5,7-dihydroxy-4-oxo-4H-chromen-2-yl)-2-methoxyphenyl]-5,7-dihydroxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 4',4'''-dimethylamentoflavone | ChemIDplus |
| iso-ginkgetin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033937 | HMDB |
| LSM-25622 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:381336 | Reaxys |
| CAS:548-19-6 | ChemIDplus |
| Citations |
|---|