EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:79079 - (4S)-4-hydroxy-L-isoleucine
| Formula | C6H13NO3 |
| Net Charge | 0 |
| Average Mass | 147.174 |
| Monoisotopic Mass | 147.08954 |
| SMILES | C[C@@H]([C@H](C)O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H13NO3/c1-3(4(2)8)5(7)6(9)10/h3-5,8H,7H2,1-2H3,(H,9,10)/t3-,4-,5-/m0/s1 |
| InChIKey | OSCCDBFHNMXNME-YUPRTTJUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4S)-4-hydroxy-L-isoleucine (CHEBI:79079) has role plant metabolite (CHEBI:76924) |
| (4S)-4-hydroxy-L-isoleucine (CHEBI:79079) is a L-isoleucine derivative (CHEBI:84111) |
| (4S)-4-hydroxy-L-isoleucine (CHEBI:79079) is a amino alcohol (CHEBI:22478) |
| (4S)-4-hydroxy-L-isoleucine (CHEBI:79079) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| (4S)-4-hydroxy-L-isoleucine (CHEBI:79079) is tautomer of (4S)-4-hydroxy-L-isoleucine zwitterion (CHEBI:78247) |
| Incoming Relation(s) |
| (4S)-4-hydroxy-L-isoleucine zwitterion (CHEBI:78247) is tautomer of (4S)-4-hydroxy-L-isoleucine (CHEBI:79079) |
| IUPAC Name |
|---|
| (2S,3R,4S)-2-amino-4-hydroxy-3-methylpentanoic acid |
| Synonyms | Source |
|---|---|
| 2-amino-2,3,5-trideoxy-3-methyl-L-ribonic acid | ChEBI |
| (2S,3R,4S)-4-Hydroxyisoleucine | ChemIDplus |
| (4S)-4-hydroxyisoleucine | ChEBI |
| Hydroxyisoleucine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-14635 | MetaCyc |
| US2010048947 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2351465 | Reaxys |
| CAS:55399-93-4 | ChemIDplus |
| Citations |
|---|