EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24O11 |
| Net Charge | 0 |
| Average Mass | 452.412 |
| Monoisotopic Mass | 452.13186 |
| SMILES | O=C(CCc1ccc(O)c(O)c1)c1c(O)cc(O)c([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1O |
| InChI | InChI=1S/C21H24O11/c22-7-14-17(28)19(30)20(31)21(32-14)16-13(27)6-12(26)15(18(16)29)10(24)4-2-8-1-3-9(23)11(25)5-8/h1,3,5-6,14,17,19-23,25-31H,2,4,7H2/t14-,17-,19+,20-,21+/m1/s1 |
| InChIKey | VCPUQYKWJRESOC-VJXVFPJBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | EC 1.17.3.2 (xanthine oxidase) inhibitor An EC 1.17.3.* (oxidoreductase acting on CH or CH2 with oxygen as acceptor) inhibitor that interferes with the action of xanthine oxidase (EC 1.17.3.2). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspalathin (CHEBI:79078) has role antioxidant (CHEBI:22586) |
| aspalathin (CHEBI:79078) has role EC 1.17.3.2 (xanthine oxidase) inhibitor (CHEBI:35634) |
| aspalathin (CHEBI:79078) has role hypoglycemic agent (CHEBI:35526) |
| aspalathin (CHEBI:79078) has role plant metabolite (CHEBI:76924) |
| aspalathin (CHEBI:79078) is a C-glycosyl compound (CHEBI:20857) |
| aspalathin (CHEBI:79078) is a catechols (CHEBI:33566) |
| aspalathin (CHEBI:79078) is a dihydrochalcones (CHEBI:71230) |
| aspalathin (CHEBI:79078) is a polyketide (CHEBI:26188) |
| aspalathin (CHEBI:79078) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-{3-[3-(3,4-dihydroxyphenyl)propanoyl]-2,4,6-trihydroxyphenyl}-D-glucitol |
| Synonyms | Source |
|---|---|
| 1-(3-C-β-D-glucopyranosyl-2,4,6-trihydroxyphenyl)-3-(3,4-dihydroxyphenyl)-1-propanone | HMDB |
| 3-(3,4-dihydroxyphenyl)-1-(3-β-D-glucopyranosyl-2,4,6-trihydroxyphenyl)-1-propanone | LIPID MAPS |
| 3-(3,4-dihydroxyphenyl)-3'-β-D-glucopyranosyl-2',4',6'-trihydroxypropiophenone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Aspalathin | Wikipedia |
| HMDB0030851 | HMDB |
| LMPK12120529 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1412711 | Reaxys |
| Citations |
|---|