EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO3 |
| Net Charge | 0 |
| Average Mass | 195.218 |
| Monoisotopic Mass | 195.08954 |
| SMILES | Cc1cc(C[C@H](N)C(=O)O)ccc1O |
| InChI | InChI=1S/C10H13NO3/c1-6-4-7(2-3-9(6)12)5-8(11)10(13)14/h2-4,8,12H,5,11H2,1H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | MQHLULPKDLJASZ-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyl-L-tyrosine (CHEBI:79076) is a L-tyrosine derivative (CHEBI:27177) |
| 3-methyl-L-tyrosine (CHEBI:79076) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 3-methyl-L-tyrosine (CHEBI:79076) is tautomer of 3-methyl-L-tyrosine zwitterion (CHEBI:78239) |
| Incoming Relation(s) |
| 3-methyl-L-tyrosine zwitterion (CHEBI:78239) is tautomer of 3-methyl-L-tyrosine (CHEBI:79076) |
| IUPAC Name |
|---|
| 3-methyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| 3-methyltyrosine | ChEBI |
| 3-Me-Tyr | ChEBI |
| Methyl-3-tyrosine | ChemIDplus |
| Citations |
|---|