EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H37O8P |
| Net Charge | 0 |
| Average Mass | 424.471 |
| Monoisotopic Mass | 424.22260 |
| SMILES | CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCC |
| InChI | InChI=1S/C19H37O8P/c1-3-5-7-9-11-13-18(20)25-15-17(16-26-28(22,23)24)27-19(21)14-12-10-8-6-4-2/h17H,3-16H2,1-2H3,(H2,22,23,24)/t17-/m1/s1 |
| InChIKey | XYSBQYUENLDGMI-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-dioctanoyl-sn-glycero-3-phosphate (CHEBI:79075) is a 1,2-diacyl-sn-glycerol 3-phosphate (CHEBI:29089) |
| 1,2-dioctanoyl-sn-glycero-3-phosphate (CHEBI:79075) is a octanoate ester (CHEBI:87657) |
| 1,2-dioctanoyl-sn-glycero-3-phosphate (CHEBI:79075) is conjugate acid of 1,2-dioctanoyl-sn-glycero-3-phosphate(2−) (CHEBI:78229) |
| Incoming Relation(s) |
| 1,2-dioctanoyl-sn-glycero-3-phosphate(2−) (CHEBI:78229) is conjugate base of 1,2-dioctanoyl-sn-glycero-3-phosphate (CHEBI:79075) |
| IUPAC Name |
|---|
| (2R)-3-(phosphonooxy)propane-1,2-diyl dioctanoate |
| Synonyms | Source |
|---|---|
| 1,2-dicapryloyl-sn-glycero-3-phosphate | ChEBI |
| 1,2-Dioctanoyl-sn-glycero-3-phosphatidic acid | LIPID MAPS |
| (2R)-2,3-bis(octanoyloxy)propyl hydrogen phosphate | PDBeChem |
| Dioctanoylphosphatidic acid | ChemIDplus |
| PA(16:0) | ChEBI |
| PA(8:0/8:0) | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMGP10010021 | LIPID MAPS |
| PA8 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8518440 | Reaxys |
| CAS:102731-57-7 | ChemIDplus |
| Citations |
|---|