EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H45O8P |
| Net Charge | 0 |
| Average Mass | 480.579 |
| Monoisotopic Mass | 480.28521 |
| SMILES | CCCCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C23H45O8P/c1-3-5-7-9-11-13-15-17-22(24)29-19-21(20-30-32(26,27)28)31-23(25)18-16-14-12-10-8-6-4-2/h21H,3-20H2,1-2H3,(H2,26,27,28)/t21-/m1/s1 |
| InChIKey | PHQFPHNJHDEXLJ-OAQYLSRUSA-N |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-dicapryl-sn-glycero-3-phosphate (CHEBI:79074) is a 1,2-diacyl-sn-glycerol 3-phosphate (CHEBI:29089) |
| 1,2-dicapryl-sn-glycero-3-phosphate (CHEBI:79074) is a decanoate ester (CHEBI:87658) |
| 1,2-dicapryl-sn-glycero-3-phosphate (CHEBI:79074) is conjugate acid of 1,2-dicapryl-sn-glycero-3-phosphate(2−) (CHEBI:78227) |
| Incoming Relation(s) |
| 1,2-dicapryl-sn-glycero-3-phosphate(2−) (CHEBI:78227) is conjugate base of 1,2-dicapryl-sn-glycero-3-phosphate (CHEBI:79074) |
| IUPAC Name |
|---|
| (2R)-3-(phosphonooxy)propane-1,2-diyl didecanoate |
| Synonyms | Source |
|---|---|
| 1,2-dicaprinyl-sn-glycero-3-phosphate | ChEBI |
| 1,2-didecanoyl-sn-glycero-3-phosphate | ChEBI |
| PA(10:0/10:0) | LIPID MAPS |
| 1,2-Didecanoyl-3-phosphatidic acid | ChemIDplus |
| 1,2-Didecanoyl-3-sn-phosphatidic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| XPA | PDBeChem |
| LMGP10010022 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:80164-20-1 | ChemIDplus |