EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33O5 |
| Net Charge | -1 |
| Average Mass | 353.479 |
| Monoisotopic Mass | 353.23335 |
| SMILES | CCCCCC(=O)/C=C/[C@@H]1[C@@H](CCCCCCC(=O)[O-])[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,16-19,22-23H,2-11,14H2,1H3,(H,24,25)/p-1/b13-12+/t16-,17-,18+,19-/m1/s1 |
| InChIKey | QPXXPLNAYDQELM-QNXXGYPUSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-ketoprostaglandin F1α(1−) (CHEBI:79072) has role human metabolite (CHEBI:77746) |
| 15-ketoprostaglandin F1α(1−) (CHEBI:79072) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| 15-ketoprostaglandin F1α(1−) (CHEBI:79072) is conjugate base of 15-ketoprostaglandin F1α (CHEBI:72593) |
| Incoming Relation(s) |
| 15-ketoprostaglandin F1α (CHEBI:72593) is conjugate acid of 15-ketoprostaglandin F1α(1−) (CHEBI:79072) |
| IUPAC Name |
|---|
| (9α,11α,13E)-9,11-dihydroxy-15-oxoprost-13-en-1-oate |
| UniProt Name | Source |
|---|---|
| 15-oxoprostaglandin F1α | UniProt |