EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N4O5S |
| Net Charge | 0 |
| Average Mass | 332.382 |
| Monoisotopic Mass | 332.11544 |
| SMILES | C[N+](C)(C)[C@@H](Cc1cnc(S(=O)C[C@H](N)C(=O)O)n1)C(=O)[O-] |
| InChI | InChI=1S/C12H20N4O5S/c1-16(2,3)9(11(19)20)4-7-5-14-12(15-7)22(21)6-8(13)10(17)18/h5,8-9H,4,6,13H2,1-3H3,(H2-,14,15,17,18,19,20)/t8-,9-,22?/m0/s1 |
| InChIKey | CSTNDZVKJNPMIG-PTZMPWRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Schizosaccharomyces pombe (ncbitaxon:4896) | - | PubMed (24828577) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hercynylcysteine sulfoxide (CHEBI:79057) has role fungal metabolite (CHEBI:76946) |
| hercynylcysteine sulfoxide (CHEBI:79057) is a L-cysteine derivative (CHEBI:83824) |
| hercynylcysteine sulfoxide (CHEBI:79057) is a L-histidine derivative (CHEBI:84076) |
| hercynylcysteine sulfoxide (CHEBI:79057) is a ammonium betaine (CHEBI:35284) |
| hercynylcysteine sulfoxide (CHEBI:79057) is a sulfoxide (CHEBI:22063) |
| hercynylcysteine sulfoxide (CHEBI:79057) is tautomer of hercynylcysteine sulfoxide zwitterion (CHEBI:82706) |
| Incoming Relation(s) |
| hercynylcysteine sulfoxide zwitterion (CHEBI:82706) is tautomer of hercynylcysteine sulfoxide (CHEBI:79057) |
| IUPAC Name |
|---|
| (2S)-3-(2-{[(2R)-2-amino-2-carboxyethyl]sulfinyl}-1H-imidazol-4-yl)-2-(trimethylazaniumyl)propanoate |
| Manual Xrefs | Databases |
|---|---|
| CPD-15277 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24604971 | Reaxys |
| Citations |
|---|