EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19NO2 |
| Net Charge | 0 |
| Average Mass | 245.322 |
| Monoisotopic Mass | 245.14158 |
| SMILES | CCC(=O)NC[C@@H]1C[C@H]1c1cccc2c1CCO2 |
| InChI | InChI=1S/C15H19NO2/c1-2-15(17)16-9-10-8-13(10)11-4-3-5-14-12(11)6-7-18-14/h3-5,10,13H,2,6-9H2,1H3,(H,16,17)/t10-,13+/m0/s1 |
| InChIKey | PTOIAAWZLUQTIO-GXFFZTMASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | melatonin receptor agonist An agonist that binds to and activates melatonin receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tasimelteon (CHEBI:79042) has functional parent propionamide (CHEBI:45422) |
| tasimelteon (CHEBI:79042) has role melatonin receptor agonist (CHEBI:79046) |
| tasimelteon (CHEBI:79042) is a 1-benzofurans (CHEBI:38830) |
| tasimelteon (CHEBI:79042) is a cyclopropanes (CHEBI:51454) |
| tasimelteon (CHEBI:79042) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| N-{[(1R,2R)-2-(2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methyl}propanamide |
| INNs | Source |
|---|---|
| tasimelteon | KEGG DRUG |
| tasimelteón | WHO MedNet |
| tasimelteonum | WHO MedNet |
| tasimeltéon | WHO MedNet |
| Synonyms | Source |
|---|---|
| BMS-214778 | ChemIDplus |
| BMS 214778 | ChemIDplus |
| VEC-162 | ChemIDplus |
| VEC 162 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Hetlioz | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D09388 | KEGG DRUG |
| WO2007137224 | Patent |
| WO2007137244 | Patent |
| WO2013173707 | Patent |
| Tasimelteon | Wikipedia |
| 4820 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15439325 | Reaxys |
| CAS:609799-22-6 | KEGG DRUG |
| CAS:609799-22-6 | ChemIDplus |
| Citations |
|---|